Questions dealing with aldehydes and ketones

  1. Outline a synthesis of the following compounds starting from either benzene or toluene:
    1. n-butylbenzene
    2. 1-phenyl-2-propanone
    3.  

    4. p-nitrobenzaldehyde

      

  2. Outline a synthesis of 3-hexene from propane.
  3. Bombykol, the sex pheromone of the silkworm moth, has been prepared in the following way:
  4.  

    1-pentyne + n-C4H9MgBr ® CH3CH2CH2CºCMgBr

     A + HCHO; then H+ ® CH3CH2CH2Cº CCH2OH

    B + PBr3 ® CH3CH2CH2CºCCH2Br

     C + Ph3P, base ® CH3CH2CH2CºCCH=PPh3

     D + OHCCH2(CH2)7CO2C2H5 ® CH3CH2CH2CºCCH=CHCH2(CH2)7CO2C2H5

    E + H2/Pd ® CH3CH2CH2CH=CHCH=CHCH2(CH2)7CO2C2H5 (cis)

    F + LiAlH4 ® CH3CH2CH2CH=CHCH=CHCH2(CH2)7CH2OH (cis)

     

  5. Propose a mechanism for the following reaction:
  6.  

  7. Compound "A", C6H12O2, was found to be optically active. Reaction with Tollens reagent gave "B", C6H12O3, an optically active carboxylic acid. (A must be an aldehyde!) Oxidation of "A" by pyridinium chlorochromate in dichloromethane gave an optically inactive compound which reacted with Zn(Hg)/HCl to give 3-methylpentane. Vigorous oxidation of "A" yielded "C", C6H10O4, an optically inactive dicarboxylic acid. Give the structures of compounds "A", "B", and "C".
  8.  A must have the 3-methylpentane carbon skeleton.

Home | Faculté Saint-Jean | University of Alberta | Chemistry Department

This page is maintained by Dr. Ed Blackburn (Ed.Blackburn@UAlberta.CA), course instructor.

Updated August 23, 2002